ChemNet > CAS > 1455-18-1 3-Methylbenzo[b]thiophene
1455-18-1 3-Methylbenzo[b]thiophene
| نام محصول |
3-Methylbenzo[b]thiophene |
| مترادف |
Methylbenzobthiophene; 3-Methylthianaphthene; 3-methyl-1-benzothiophene |
| میدان مغناطیسی |
C9H8S |
| وزن مولکولی |
148.2248 |
| InChI |
InChI=1/C9H8S/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| شماره سیایاس |
1455-18-1 |
| تعداد کمیسیون اروپایی |
215-934-6 |
| ساختار مولکولی |
![1455-18-1 3-Methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/485/136485.gif)
|
| تراکم |
1.146g/cm3 |
| نقطه غلیان |
243°C at 760 mmHg |
| ضریب شکست |
1.652 |
| نقطه اشتعال |
72.4°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
